C12H14F2N2 — CID 164763836
2-(2,5-difluoro-1H-indol-3-yl)-N,N-dimethylethanamine (PubChem CID 164763836) has the molecular formula C12H14F2N2 and a molecular weight of 224.25 g/mol. Its IUPAC name is 2-(2,5-difluoro-1H-indol-3-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(2,5-difluoro-1H-indol-3-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 164763836 |
| Molecular Formula | C12H14F2N2 |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 2-(2,5-difluoro-1H-indol-3-yl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCc1c(F)[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C12H14F2N2/c1-16(2)6-5-9-10-7-8(13)3-4-11(10)15-12(9)14/h3-4,7,15H,5-6H2,1-2H3 |
| InChIKey | PSWKLEVPMHYJKH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |