C20H21F2N3O — CID 22611290
N-[3-[2-(dimethylamino)ethyl]-2-methyl-1H-indol-5-yl]-2,5-difluorobenzamide (PubChem CID 22611290) has the molecular formula C20H21F2N3O and a molecular weight of 357.40 g/mol. Its IUPAC name is N-[3-[2-(dimethylamino)ethyl]-2-methyl-1H-indol-5-yl]-2,5-difluorobenzamide.
| Compound Name | N-[3-[2-(dimethylamino)ethyl]-2-methyl-1H-indol-5-yl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 22611290 |
| Molecular Formula | C20H21F2N3O |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-[3-[2-(dimethylamino)ethyl]-2-methyl-1H-indol-5-yl]-2,5-difluorobenzamide |
| SMILES | Cc1[nH]c2ccc(NC(=O)c3cc(F)ccc3F)cc2c1CCN(C)C |
| InChI | InChI=1S/C20H21F2N3O/c1-12-15(8-9-25(2)3)16-11-14(5-7-19(16)23-12)24-20(26)17-10-13(21)4-6-18(17)22/h4-7,10-11,23H,8-9H2,1-3H3,(H,24,26) |
| InChIKey | JHRDRJJVBFWXJI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|