C24H24FN3O3 — CID 23290463
4-fluoro-N-[3-[2-[[5-(hydroxymethyl)furan-2-yl]methylamino]ethyl]-2-methyl-1H-indol-5-yl]benzamide (PubChem CID 23290463) has the molecular formula C24H24FN3O3 and a molecular weight of 421.47 g/mol. Its IUPAC name is 4-fluoro-N-[3-[2-[[5-(hydroxymethyl)furan-2-yl]methylamino]ethyl]-2-methyl-1H-indol-5-yl]benzamide.
| Compound Name | 4-fluoro-N-[3-[2-[[5-(hydroxymethyl)furan-2-yl]methylamino]ethyl]-2-methyl-1H-indol-5-yl]benzamide |
|---|---|
| PubChem CID | 23290463 |
| Molecular Formula | C24H24FN3O3 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 4-fluoro-N-[3-[2-[[5-(hydroxymethyl)furan-2-yl]methylamino]ethyl]-2-methyl-1H-indol-5-yl]benzamide |
| SMILES | Cc1[nH]c2ccc(NC(=O)c3ccc(F)cc3)cc2c1CCNCc1ccc(CO)o1 |
| InChI | InChI=1S/C24H24FN3O3/c1-15-21(10-11-26-13-19-7-8-20(14-29)31-19)22-12-18(6-9-23(22)27-15)28-24(30)16-2-4-17(25)5-3-16/h2-9,12,26-27,29H,10-11,13-14H2,1H3,(H,28,30) |
| InChIKey | LRVIUGWOYXKXHO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|