C13H13F4NO — CID 78858681
(E)-N-ethyl-3-(4-fluorophenyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide (PubChem CID 78858681) has the molecular formula C13H13F4NO and a molecular weight of 275.25 g/mol. Its IUPAC name is (E)-N-ethyl-3-(4-fluorophenyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide.
| Compound Name | (E)-N-ethyl-3-(4-fluorophenyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
|---|---|
| PubChem CID | 78858681 |
| Molecular Formula | C13H13F4NO |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | (E)-N-ethyl-3-(4-fluorophenyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
| SMILES | CCN(CC(F)(F)F)C(=O)/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C13H13F4NO/c1-2-18(9-13(15,16)17)12(19)8-5-10-3-6-11(14)7-4-10/h3-8H,2,9H2,1H3/b8-5+ |
| InChIKey | CHQBBOJJJHDYCZ-VMPITWQZSA-N |
| XLogP | 3.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|