C11H20F2IO3P — CID 11090556
(E)-1-diethoxyphosphoryl-1,1-difluoro-3-iodohept-2-ene (PubChem CID 11090556) has the molecular formula C11H20F2IO3P and a molecular weight of 396.15 g/mol. Its IUPAC name is (E)-1-diethoxyphosphoryl-1,1-difluoro-3-iodohept-2-ene.
| Compound Name | (E)-1-diethoxyphosphoryl-1,1-difluoro-3-iodohept-2-ene |
|---|---|
| PubChem CID | 11090556 |
| Molecular Formula | C11H20F2IO3P |
| Molecular Weight | 396.15 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | (E)-1-diethoxyphosphoryl-1,1-difluoro-3-iodohept-2-ene |
| SMILES | CCCC/C(I)=C\C(F)(F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C11H20F2IO3P/c1-4-7-8-10(14)9-11(12,13)18(15,16-5-2)17-6-3/h9H,4-8H2,1-3H3/b10-9+ |
| InChIKey | RACQYACWRTUDBO-MDZDMXLPSA-N |
| XLogP | 5.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.15 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|