C35H52O8Si — CID 70658574
[(2S,5R)-2-acetyloxy-4-butoxy-5-(butoxymethyl)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxolan-3-yl] acetate (PubChem CID 70658574) has the molecular formula C35H52O8Si and a molecular weight of 628.88 g/mol. Its IUPAC name is [(2S,5R)-2-acetyloxy-4-butoxy-5-(butoxymethyl)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxolan-3-yl] acetate.
| Compound Name | [(2S,5R)-2-acetyloxy-4-butoxy-5-(butoxymethyl)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 70658574 |
| Molecular Formula | C35H52O8Si |
| Molecular Weight | 628.88 g/mol |
| Exact Mass | 628.34 |
| IUPAC Name | [(2S,5R)-2-acetyloxy-4-butoxy-5-(butoxymethyl)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]oxolan-3-yl] acetate |
| SMILES | CCCCOC[C@@]1(CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@H](OC(C)=O)C(OC(C)=O)C1OCCCC |
| InChI | InChI=1S/C35H52O8Si/c1-8-10-23-38-26-35(32(39-24-11-9-2)31(41-27(3)36)33(43-35)42-28(4)37)22-25-40-44(34(5,6)7,29-18-14-12-15-19-29)30-20-16-13-17-21-30/h12-21,31-33H,8-11,22-26H2,1-7H3/t31?,32?,33-,35-/m1/s1 |
| InChIKey | DHFOHKZQVVJODX-JEMXCSDLSA-N |
| XLogP | 5.55 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.88 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|