C35H54O7Si — CID 89338417
(3R,4S,5R,6R)-3,4,5-tributoxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxyoxane-2-carbaldehyde (PubChem CID 89338417) has the molecular formula C35H54O7Si and a molecular weight of 614.90 g/mol. Its IUPAC name is (3R,4S,5R,6R)-3,4,5-tributoxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxyoxane-2-carbaldehyde.
| Compound Name | (3R,4S,5R,6R)-3,4,5-tributoxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxyoxane-2-carbaldehyde |
|---|---|
| PubChem CID | 89338417 |
| Molecular Formula | C35H54O7Si |
| Molecular Weight | 614.90 g/mol |
| Exact Mass | 614.36 |
| IUPAC Name | (3R,4S,5R,6R)-3,4,5-tributoxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxyoxane-2-carbaldehyde |
| SMILES | CCCCO[C@H]1[C@H](OCCCC)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(O)(C=O)[C@@H]1OCCCC |
| InChI | InChI=1S/C35H54O7Si/c1-7-10-23-38-31-30(42-35(37,27-36)33(40-25-12-9-3)32(31)39-24-11-8-2)26-41-43(34(4,5)6,28-19-15-13-16-20-28)29-21-17-14-18-22-29/h13-22,27,30-33,37H,7-12,23-26H2,1-6H3/t30-,31-,32+,33-,35?/m1/s1 |
| InChIKey | CACQTZBLAQSEIS-NCSHYKNISA-N |
| XLogP | 5.41 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.90 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|