C31H52O6 — CID 89431381
(2S,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-[(Z)-1-phenylprop-1-enyl]oxan-2-ol (PubChem CID 89431381) has the molecular formula C31H52O6 and a molecular weight of 520.75 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-[(Z)-1-phenylprop-1-enyl]oxan-2-ol.
| Compound Name | (2S,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-[(Z)-1-phenylprop-1-enyl]oxan-2-ol |
|---|---|
| PubChem CID | 89431381 |
| Molecular Formula | C31H52O6 |
| Molecular Weight | 520.75 g/mol |
| Exact Mass | 520.38 |
| IUPAC Name | (2S,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-[(Z)-1-phenylprop-1-enyl]oxan-2-ol |
| SMILES | C/C=C(/c1ccccc1)[C@]1(O)O[C@H](COCCCC)[C@@H](OCCCC)[C@H](OCCCC)[C@H]1OCCCC |
| InChI | InChI=1S/C31H52O6/c1-6-11-20-33-24-27-28(34-21-12-7-2)29(35-22-13-8-3)30(36-23-14-9-4)31(32,37-27)26(10-5)25-18-16-15-17-19-25/h10,15-19,27-30,32H,6-9,11-14,20-24H2,1-5H3/b26-10-/t27-,28-,29+,30-,31+/m1/s1 |
| InChIKey | GUSHXSPMTTZEKB-ZGHWSEIBSA-N |
| XLogP | 6.55 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.75 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|