C24H41NO4 — CID 70835497
(3S,4R,5R)-N-benzyl-3,4-dibutoxy-5-(butoxymethyl)oxolan-2-amine (PubChem CID 70835497) has the molecular formula C24H41NO4 and a molecular weight of 407.60 g/mol. Its IUPAC name is (3S,4R,5R)-N-benzyl-3,4-dibutoxy-5-(butoxymethyl)oxolan-2-amine.
| Compound Name | (3S,4R,5R)-N-benzyl-3,4-dibutoxy-5-(butoxymethyl)oxolan-2-amine |
|---|---|
| PubChem CID | 70835497 |
| Molecular Formula | C24H41NO4 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.30 |
| IUPAC Name | (3S,4R,5R)-N-benzyl-3,4-dibutoxy-5-(butoxymethyl)oxolan-2-amine |
| SMILES | CCCCOC[C@H]1OC(NCc2ccccc2)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C24H41NO4/c1-4-7-15-26-19-21-22(27-16-8-5-2)23(28-17-9-6-3)24(29-21)25-18-20-13-11-10-12-14-20/h10-14,21-25H,4-9,15-19H2,1-3H3/t21-,22-,23+,24?/m1/s1 |
| InChIKey | PSMKTGYVMPUICS-KEUGWDJXSA-N |
| XLogP | 4.69 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|