C30H50O5 — CID 88974703
(2R,3S,4S,5R,6Z)-3,4,5-tributoxy-2-(butoxymethyl)-6-(1-phenylethylidene)oxane (PubChem CID 88974703) has the molecular formula C30H50O5 and a molecular weight of 490.73 g/mol. Its IUPAC name is (2R,3S,4S,5R,6Z)-3,4,5-tributoxy-2-(butoxymethyl)-6-(1-phenylethylidene)oxane.
| Compound Name | (2R,3S,4S,5R,6Z)-3,4,5-tributoxy-2-(butoxymethyl)-6-(1-phenylethylidene)oxane |
|---|---|
| PubChem CID | 88974703 |
| Molecular Formula | C30H50O5 |
| Molecular Weight | 490.73 g/mol |
| Exact Mass | 490.37 |
| IUPAC Name | (2R,3S,4S,5R,6Z)-3,4,5-tributoxy-2-(butoxymethyl)-6-(1-phenylethylidene)oxane |
| SMILES | CCCCOC[C@H]1O/C(=C(/C)c2ccccc2)C(OCCCC)[C@@H](OCCCC)[C@H]1OCCCC |
| InChI | InChI=1S/C30H50O5/c1-6-10-19-31-23-26-28(32-20-11-7-2)30(34-22-13-9-4)29(33-21-12-8-3)27(35-26)24(5)25-17-15-14-16-18-25/h14-18,26,28-30H,6-13,19-23H2,1-5H3/b27-24-/t26-,28+,29?,30+/m1/s1 |
| InChIKey | JLIUAQLWGLKBRL-NRPXKEAJSA-N |
| XLogP | 7.19 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.73 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|