C30H50O6 — CID 89431555
(2S,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-(1-phenylethenyl)oxan-2-ol (PubChem CID 89431555) has the molecular formula C30H50O6 and a molecular weight of 506.72 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-(1-phenylethenyl)oxan-2-ol.
| Compound Name | (2S,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-(1-phenylethenyl)oxan-2-ol |
|---|---|
| PubChem CID | 89431555 |
| Molecular Formula | C30H50O6 |
| Molecular Weight | 506.72 g/mol |
| Exact Mass | 506.36 |
| IUPAC Name | (2S,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-(1-phenylethenyl)oxan-2-ol |
| SMILES | C=C(c1ccccc1)[C@]1(O)O[C@H](COCCCC)[C@@H](OCCCC)[C@H](OCCCC)[C@H]1OCCCC |
| InChI | InChI=1S/C30H50O6/c1-6-10-19-32-23-26-27(33-20-11-7-2)28(34-21-12-8-3)29(35-22-13-9-4)30(31,36-26)24(5)25-17-15-14-16-18-25/h14-18,26-29,31H,5-13,19-23H2,1-4H3/t26-,27-,28+,29-,30+/m1/s1 |
| InChIKey | ANLUTHVQLLEDGX-RLXMVLCYSA-N |
| XLogP | 6.16 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.72 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|