C34H58O8 — CID 70793046
(4-butoxyphenyl)-[(2R,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-methoxyoxan-2-yl]methanone (PubChem CID 70793046) has the molecular formula C34H58O8 and a molecular weight of 594.83 g/mol. Its IUPAC name is (4-butoxyphenyl)-[(2R,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-methoxyoxan-2-yl]methanone.
| Compound Name | (4-butoxyphenyl)-[(2R,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-methoxyoxan-2-yl]methanone |
|---|---|
| PubChem CID | 70793046 |
| Molecular Formula | C34H58O8 |
| Molecular Weight | 594.83 g/mol |
| Exact Mass | 594.41 |
| IUPAC Name | (4-butoxyphenyl)-[(2R,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-methoxyoxan-2-yl]methanone |
| SMILES | CCCCOC[C@H]1O[C@@](OC)(C(=O)c2ccc(OCCCC)cc2)[C@H](OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C34H58O8/c1-7-12-21-37-26-29-30(39-23-14-9-3)31(40-24-15-10-4)33(41-25-16-11-5)34(36-6,42-29)32(35)27-17-19-28(20-18-27)38-22-13-8-2/h17-20,29-31,33H,7-16,21-26H2,1-6H3/t29-,30-,31+,33-,34+/m1/s1 |
| InChIKey | GIVNDCMIKQNBGP-PQOUVBHXSA-N |
| XLogP | 7.16 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.83 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|