C37H40O6 — CID 58133498
[(2R,3R,4S,5R,6R)-6-ethyl-2-methoxy-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]-(4-phenylmethoxyphenyl)methanone (PubChem CID 58133498) has the molecular formula C37H40O6 and a molecular weight of 580.72 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-6-ethyl-2-methoxy-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]-(4-phenylmethoxyphenyl)methanone.
| Compound Name | [(2R,3R,4S,5R,6R)-6-ethyl-2-methoxy-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]-(4-phenylmethoxyphenyl)methanone |
|---|---|
| PubChem CID | 58133498 |
| Molecular Formula | C37H40O6 |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-6-ethyl-2-methoxy-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]-(4-phenylmethoxyphenyl)methanone |
| SMILES | CC[C@H]1O[C@@](OC)(C(=O)c2ccc(OCc3ccccc3)cc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C37H40O6/c1-4-33-27(2)34(41-25-29-16-10-6-11-17-29)36(42-26-30-18-12-7-13-19-30)37(39-3,43-33)35(38)31-20-22-32(23-21-31)40-24-28-14-8-5-9-15-28/h5-23,27,33-34,36H,4,24-26H2,1-3H3/t27-,33-,34+,36-,37+/m1/s1 |
| InChIKey | KCBCOFBKGIYQHB-FQGWJKIFSA-N |
| XLogP | 7.41 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |