C31H36O4 — CID 90441634
(2R,3'S,4'S,5'S,6'R)-6'-ethyl-4',5'-dimethyl-3',6-bis(phenylmethoxy)spiro[3,4-dihydrochromene-2,2'-oxane] (PubChem CID 90441634) has the molecular formula C31H36O4 and a molecular weight of 472.63 g/mol. Its IUPAC name is (2R,3'S,4'S,5'S,6'R)-6'-ethyl-4',5'-dimethyl-3',6-bis(phenylmethoxy)spiro[3,4-dihydrochromene-2,2'-oxane].
| Compound Name | (2R,3'S,4'S,5'S,6'R)-6'-ethyl-4',5'-dimethyl-3',6-bis(phenylmethoxy)spiro[3,4-dihydrochromene-2,2'-oxane] |
|---|---|
| PubChem CID | 90441634 |
| Molecular Formula | C31H36O4 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | (2R,3'S,4'S,5'S,6'R)-6'-ethyl-4',5'-dimethyl-3',6-bis(phenylmethoxy)spiro[3,4-dihydrochromene-2,2'-oxane] |
| SMILES | CC[C@H]1O[C@@]2(CCc3cc(OCc4ccccc4)ccc3O2)[C@@H](OCc2ccccc2)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C31H36O4/c1-4-28-22(2)23(3)30(33-21-25-13-9-6-10-14-25)31(34-28)18-17-26-19-27(15-16-29(26)35-31)32-20-24-11-7-5-8-12-24/h5-16,19,22-23,28,30H,4,17-18,20-21H2,1-3H3/t22-,23-,28+,30-,31+/m0/s1 |
| InChIKey | FHMUEFPJQZZEDO-RBIOWLSWSA-N |
| XLogP | 6.95 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |