C22H26O3 — CID 110145787
(2S,4aS,10bS)-2,5,5-trimethyl-9-phenylmethoxy-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene (PubChem CID 110145787) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is (2S,4aS,10bS)-2,5,5-trimethyl-9-phenylmethoxy-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene.
| Compound Name | (2S,4aS,10bS)-2,5,5-trimethyl-9-phenylmethoxy-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene |
|---|---|
| PubChem CID | 110145787 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (2S,4aS,10bS)-2,5,5-trimethyl-9-phenylmethoxy-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene |
| SMILES | C[C@H]1CC[C@H]2[C@H](O1)c1cc(OCc3ccccc3)ccc1OC2(C)C |
| InChI | InChI=1S/C22H26O3/c1-15-9-11-19-21(24-15)18-13-17(10-12-20(18)25-22(19,2)3)23-14-16-7-5-4-6-8-16/h4-8,10,12-13,15,19,21H,9,11,14H2,1-3H3/t15-,19-,21+/m0/s1 |
| InChIKey | GDVMJCKMWLTIFI-PAXLWEDBSA-N |
| XLogP | 5.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |