C27H28O3 — CID 110146068
(2R,4aS,10bS)-5,5-dimethyl-2-phenyl-9-phenylmethoxy-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene (PubChem CID 110146068) has the molecular formula C27H28O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is (2R,4aS,10bS)-5,5-dimethyl-2-phenyl-9-phenylmethoxy-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene.
| Compound Name | (2R,4aS,10bS)-5,5-dimethyl-2-phenyl-9-phenylmethoxy-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene |
|---|---|
| PubChem CID | 110146068 |
| Molecular Formula | C27H28O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | (2R,4aS,10bS)-5,5-dimethyl-2-phenyl-9-phenylmethoxy-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene |
| SMILES | CC1(C)Oc2ccc(OCc3ccccc3)cc2[C@H]2O[C@@H](c3ccccc3)CC[C@@H]21 |
| InChI | InChI=1S/C27H28O3/c1-27(2)23-14-16-24(20-11-7-4-8-12-20)29-26(23)22-17-21(13-15-25(22)30-27)28-18-19-9-5-3-6-10-19/h3-13,15,17,23-24,26H,14,16,18H2,1-2H3/t23-,24+,26+/m0/s1 |
| InChIKey | BJVLKPMPONDABQ-BFLUCZKCSA-N |
| XLogP | 6.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |