C32H39NO3 — CID 110076240
N-[[(2S,4aS,10bS)-2,5,5-trimethyl-9-phenylmethoxy-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromen-8-yl]methyl]-N-methyl-2-phenylethanamine (PubChem CID 110076240) has the molecular formula C32H39NO3 and a molecular weight of 485.67 g/mol. Its IUPAC name is N-[[(2S,4aS,10bS)-2,5,5-trimethyl-9-phenylmethoxy-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromen-8-yl]methyl]-N-methyl-2-phenylethanamine.
| Compound Name | N-[[(2S,4aS,10bS)-2,5,5-trimethyl-9-phenylmethoxy-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromen-8-yl]methyl]-N-methyl-2-phenylethanamine |
|---|---|
| PubChem CID | 110076240 |
| Molecular Formula | C32H39NO3 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | N-[[(2S,4aS,10bS)-2,5,5-trimethyl-9-phenylmethoxy-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromen-8-yl]methyl]-N-methyl-2-phenylethanamine |
| SMILES | C[C@H]1CC[C@H]2[C@H](O1)c1cc(OCc3ccccc3)c(CN(C)CCc3ccccc3)cc1OC2(C)C |
| InChI | InChI=1S/C32H39NO3/c1-23-15-16-28-31(35-23)27-20-29(34-22-25-13-9-6-10-14-25)26(19-30(27)36-32(28,2)3)21-33(4)18-17-24-11-7-5-8-12-24/h5-14,19-20,23,28,31H,15-18,21-22H2,1-4H3/t23-,28-,31+/m0/s1 |
| InChIKey | YVYWWBFVDMPKJO-LAJKQIPCSA-N |
| XLogP | 6.97 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |