C21H24O2 — CID 110145788
(2S,4aS,10bS)-2,5,5-trimethyl-9-phenyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene (PubChem CID 110145788) has the molecular formula C21H24O2 and a molecular weight of 308.42 g/mol. Its IUPAC name is (2S,4aS,10bS)-2,5,5-trimethyl-9-phenyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene.
| Compound Name | (2S,4aS,10bS)-2,5,5-trimethyl-9-phenyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene |
|---|---|
| PubChem CID | 110145788 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | (2S,4aS,10bS)-2,5,5-trimethyl-9-phenyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene |
| SMILES | C[C@H]1CC[C@H]2[C@H](O1)c1cc(-c3ccccc3)ccc1OC2(C)C |
| InChI | InChI=1S/C21H24O2/c1-14-9-11-18-20(22-14)17-13-16(15-7-5-4-6-8-15)10-12-19(17)23-21(18,2)3/h4-8,10,12-14,18,20H,9,11H2,1-3H3/t14-,18-,20+/m0/s1 |
| InChIKey | XARMIMPJFJZYIC-ADLFWFRXSA-N |
| XLogP | 5.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |