C23H25FO4 — CID 110146097
methyl (2R,4aS,10bS)-2-[(4-fluorophenyl)methyl]-5,5-dimethyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-9-carboxylate (PubChem CID 110146097) has the molecular formula C23H25FO4 and a molecular weight of 384.45 g/mol. Its IUPAC name is methyl (2R,4aS,10bS)-2-[(4-fluorophenyl)methyl]-5,5-dimethyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-9-carboxylate.
| Compound Name | methyl (2R,4aS,10bS)-2-[(4-fluorophenyl)methyl]-5,5-dimethyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-9-carboxylate |
|---|---|
| PubChem CID | 110146097 |
| Molecular Formula | C23H25FO4 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | methyl (2R,4aS,10bS)-2-[(4-fluorophenyl)methyl]-5,5-dimethyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-9-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[C@H]1O[C@@H](Cc3ccc(F)cc3)CC[C@@H]1C(C)(C)O2 |
| InChI | InChI=1S/C23H25FO4/c1-23(2)19-10-9-17(12-14-4-7-16(24)8-5-14)27-21(19)18-13-15(22(25)26-3)6-11-20(18)28-23/h4-8,11,13,17,19,21H,9-10,12H2,1-3H3/t17-,19+,21-/m1/s1 |
| InChIKey | WFWYOQGRWXUSON-SLYNCCJLSA-N |
| XLogP | 4.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |