C19H24O5 — CID 110160360
methyl (1S,10S,12R,17S)-9,9-dimethyl-8,14,18-trioxatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-4-carboxylate (PubChem CID 110160360) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is methyl (1S,10S,12R,17S)-9,9-dimethyl-8,14,18-trioxatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-4-carboxylate.
| Compound Name | methyl (1S,10S,12R,17S)-9,9-dimethyl-8,14,18-trioxatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-4-carboxylate |
|---|---|
| PubChem CID | 110160360 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | methyl (1S,10S,12R,17S)-9,9-dimethyl-8,14,18-trioxatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-4-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[C@H]1O[C@H]3CCOC[C@H]3C[C@@H]1C(C)(C)O2 |
| InChI | InChI=1S/C19H24O5/c1-19(2)14-9-12-10-22-7-6-15(12)23-17(14)13-8-11(18(20)21-3)4-5-16(13)24-19/h4-5,8,12,14-15,17H,6-7,9-10H2,1-3H3/t12-,14+,15+,17-/m1/s1 |
| InChIKey | LDJZLDUECFHXKU-VWNJHIHFSA-N |
| XLogP | 3.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |