C26H30N2O5 — CID 110147946
3-[[2-[(1R,10R,12R,17R)-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-trien-14-yl]acetyl]amino]benzoic acid (PubChem CID 110147946) has the molecular formula C26H30N2O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is 3-[[2-[(1R,10R,12R,17R)-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-trien-14-yl]acetyl]amino]benzoic acid.
| Compound Name | 3-[[2-[(1R,10R,12R,17R)-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-trien-14-yl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 110147946 |
| Molecular Formula | C26H30N2O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 3-[[2-[(1R,10R,12R,17R)-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-trien-14-yl]acetyl]amino]benzoic acid |
| SMILES | CC1(C)Oc2ccccc2[C@@H]2O[C@@H]3CCN(CC(=O)Nc4cccc(C(=O)O)c4)C[C@H]3C[C@H]21 |
| InChI | InChI=1S/C26H30N2O5/c1-26(2)20-13-17-14-28(15-23(29)27-18-7-5-6-16(12-18)25(30)31)11-10-21(17)32-24(20)19-8-3-4-9-22(19)33-26/h3-9,12,17,20-21,24H,10-11,13-15H2,1-2H3,(H,27,29)(H,30,31)/t17-,20-,21-,24+/m1/s1 |
| InChIKey | NYCLLXXOJZOLDU-ONOGEGBSSA-N |
| XLogP | 3.96 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |