C30H38N2O5 — CID 129457064
benzyl N-[(2S)-1-[(1R,10R,12S,17R)-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-trien-14-yl]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 129457064) has the molecular formula C30H38N2O5 and a molecular weight of 506.64 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[(1R,10R,12S,17R)-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-trien-14-yl]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[(1R,10R,12S,17R)-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-trien-14-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 129457064 |
| Molecular Formula | C30H38N2O5 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | benzyl N-[(2S)-1-[(1R,10R,12S,17R)-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-trien-14-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)N1CC[C@H]2O[C@H]3c4ccccc4OC(C)(C)[C@@H]3C[C@H]2C1 |
| InChI | InChI=1S/C30H38N2O5/c1-19(2)26(31-29(34)35-18-20-10-6-5-7-11-20)28(33)32-15-14-24-21(17-32)16-23-27(36-24)22-12-8-9-13-25(22)37-30(23,3)4/h5-13,19,21,23-24,26-27H,14-18H2,1-4H3,(H,31,34)/t21-,23+,24+,26-,27-/m0/s1 |
| InChIKey | OASDFIFLYSMCEO-QOVPHWQRSA-N |
| XLogP | 5.10 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |