C34H38N2O5 — CID 110076212
benzyl N-[(2S)-1-[(1S,10S,12R,17S)-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-trien-14-yl]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 110076212) has the molecular formula C34H38N2O5 and a molecular weight of 554.69 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[(1S,10S,12R,17S)-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-trien-14-yl]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[(1S,10S,12R,17S)-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-trien-14-yl]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 110076212 |
| Molecular Formula | C34H38N2O5 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.28 |
| IUPAC Name | benzyl N-[(2S)-1-[(1S,10S,12R,17S)-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-trien-14-yl]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CC1(C)Oc2ccccc2[C@H]2O[C@H]3CCN(C(=O)[C@H](Cc4ccccc4)NC(=O)OCc4ccccc4)C[C@H]3C[C@@H]21 |
| InChI | InChI=1S/C34H38N2O5/c1-34(2)27-20-25-21-36(18-17-29(25)40-31(27)26-15-9-10-16-30(26)41-34)32(37)28(19-23-11-5-3-6-12-23)35-33(38)39-22-24-13-7-4-8-14-24/h3-16,25,27-29,31H,17-22H2,1-2H3,(H,35,38)/t25-,27+,28+,29+,31-/m1/s1 |
| InChIKey | CDAYYZUOENCUFD-GXPIJPPGSA-N |
| XLogP | 5.69 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |