C21H27NO6 — CID 110160232
2-[2-[(1R,10R,12S,17R)-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-trien-14-yl]-2-oxoethoxy]acetic acid (PubChem CID 110160232) has the molecular formula C21H27NO6 and a molecular weight of 389.45 g/mol. Its IUPAC name is 2-[2-[(1R,10R,12S,17R)-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-trien-14-yl]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[(1R,10R,12S,17R)-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-trien-14-yl]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 110160232 |
| Molecular Formula | C21H27NO6 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 2-[2-[(1R,10R,12S,17R)-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-trien-14-yl]-2-oxoethoxy]acetic acid |
| SMILES | CC1(C)Oc2ccccc2[C@@H]2O[C@@H]3CCN(C(=O)COCC(=O)O)C[C@@H]3C[C@H]21 |
| InChI | InChI=1S/C21H27NO6/c1-21(2)15-9-13-10-22(18(23)11-26-12-19(24)25)8-7-16(13)27-20(15)14-5-3-4-6-17(14)28-21/h3-6,13,15-16,20H,7-12H2,1-2H3,(H,24,25)/t13-,15+,16+,20-/m0/s1 |
| InChIKey | DVQMCQZYXIXQRE-MNFOOTCESA-N |
| XLogP | 2.25 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |