C26H29NO7 — CID 110148028
2-[2-[(1R,10R,12S,17R)-6-hydroxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-14-carbonyl]phenoxy]acetic acid (PubChem CID 110148028) has the molecular formula C26H29NO7 and a molecular weight of 467.52 g/mol. Its IUPAC name is 2-[2-[(1R,10R,12S,17R)-6-hydroxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-14-carbonyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[(1R,10R,12S,17R)-6-hydroxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-14-carbonyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 110148028 |
| Molecular Formula | C26H29NO7 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 2-[2-[(1R,10R,12S,17R)-6-hydroxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-14-carbonyl]phenoxy]acetic acid |
| SMILES | CC1(C)Oc2c(O)cccc2[C@@H]2O[C@@H]3CCN(C(=O)c4ccccc4OCC(=O)O)C[C@@H]3C[C@H]21 |
| InChI | InChI=1S/C26H29NO7/c1-26(2)18-12-15-13-27(25(31)16-6-3-4-9-21(16)32-14-22(29)30)11-10-20(15)33-23(18)17-7-5-8-19(28)24(17)34-26/h3-9,15,18,20,23,28H,10-14H2,1-2H3,(H,29,30)/t15-,18+,20+,23-/m0/s1 |
| InChIKey | MCKMTLNUULXFNV-RZBWMALZSA-N |
| XLogP | 3.64 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |