C28H33NO7 — CID 110147979
2-[3-[(1R,10R,12R,17R)-6-ethoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-14-carbonyl]phenoxy]acetic acid (PubChem CID 110147979) has the molecular formula C28H33NO7 and a molecular weight of 495.57 g/mol. Its IUPAC name is 2-[3-[(1R,10R,12R,17R)-6-ethoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-14-carbonyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[(1R,10R,12R,17R)-6-ethoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-14-carbonyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 110147979 |
| Molecular Formula | C28H33NO7 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 2-[3-[(1R,10R,12R,17R)-6-ethoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-14-carbonyl]phenoxy]acetic acid |
| SMILES | CCOc1cccc2c1OC(C)(C)[C@@H]1C[C@@H]3CN(C(=O)c4cccc(OCC(=O)O)c4)CC[C@H]3O[C@@H]21 |
| InChI | InChI=1S/C28H33NO7/c1-4-33-23-10-6-9-20-25-21(28(2,3)36-26(20)23)14-18-15-29(12-11-22(18)35-25)27(32)17-7-5-8-19(13-17)34-16-24(30)31/h5-10,13,18,21-22,25H,4,11-12,14-16H2,1-3H3,(H,30,31)/t18-,21-,22-,25+/m1/s1 |
| InChIKey | QSJYNUDMGYUELW-FMNIHWTGSA-N |
| XLogP | 4.33 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |