C27H33NO5 — CID 110147688
4-[[(1R,10R,12R,17R)-6-ethoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]methyl]benzoic acid (PubChem CID 110147688) has the molecular formula C27H33NO5 and a molecular weight of 451.56 g/mol. Its IUPAC name is 4-[[(1R,10R,12R,17R)-6-ethoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]methyl]benzoic acid.
| Compound Name | 4-[[(1R,10R,12R,17R)-6-ethoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 110147688 |
| Molecular Formula | C27H33NO5 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 4-[[(1R,10R,12R,17R)-6-ethoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]methyl]benzoic acid |
| SMILES | CCOc1cccc2c1OC(C)(C)[C@@H]1C[C@@H]3CN(Cc4ccc(C(=O)O)cc4)CC[C@H]3O[C@@H]21 |
| InChI | InChI=1S/C27H33NO5/c1-4-31-23-7-5-6-20-24-21(27(2,3)33-25(20)23)14-19-16-28(13-12-22(19)32-24)15-17-8-10-18(11-9-17)26(29)30/h5-11,19,21-22,24H,4,12-16H2,1-3H3,(H,29,30)/t19-,21-,22-,24+/m1/s1 |
| InChIKey | AWHKFOPXPNYMMS-YJRNTSOCSA-N |
| XLogP | 4.92 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |