C28H33N3O5 — CID 110148084
4-[2-[(1S,10S,12R,17S)-6-methoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]acetyl]-1,3-dihydroquinoxalin-2-one (PubChem CID 110148084) has the molecular formula C28H33N3O5 and a molecular weight of 491.59 g/mol. Its IUPAC name is 4-[2-[(1S,10S,12R,17S)-6-methoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]acetyl]-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-[2-[(1S,10S,12R,17S)-6-methoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]acetyl]-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 110148084 |
| Molecular Formula | C28H33N3O5 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | 4-[2-[(1S,10S,12R,17S)-6-methoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]acetyl]-1,3-dihydroquinoxalin-2-one |
| SMILES | COc1cccc2c1OC(C)(C)[C@H]1C[C@@H]3CN(CC(=O)N4CC(=O)Nc5ccccc54)CC[C@@H]3O[C@H]21 |
| InChI | InChI=1S/C28H33N3O5/c1-28(2)19-13-17-14-30(16-25(33)31-15-24(32)29-20-8-4-5-9-21(20)31)12-11-22(17)35-26(19)18-7-6-10-23(34-3)27(18)36-28/h4-10,17,19,22,26H,11-16H2,1-3H3,(H,29,32)/t17-,19+,22+,26-/m1/s1 |
| InChIKey | WSLNLFCNLHKJJQ-DFTONYJCSA-N |
| XLogP | 3.62 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |