C27H30ClN3O4 — CID 110157234
4-[2-[(1R,10R,12R,17R)-4-chloro-9,9-dimethyl-8,18-dioxa-13-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-13-yl]acetyl]-1,3-dihydroquinoxalin-2-one (PubChem CID 110157234) has the molecular formula C27H30ClN3O4 and a molecular weight of 496.01 g/mol. Its IUPAC name is 4-[2-[(1R,10R,12R,17R)-4-chloro-9,9-dimethyl-8,18-dioxa-13-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-13-yl]acetyl]-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-[2-[(1R,10R,12R,17R)-4-chloro-9,9-dimethyl-8,18-dioxa-13-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-13-yl]acetyl]-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 110157234 |
| Molecular Formula | C27H30ClN3O4 |
| Molecular Weight | 496.01 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 4-[2-[(1R,10R,12R,17R)-4-chloro-9,9-dimethyl-8,18-dioxa-13-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-13-yl]acetyl]-1,3-dihydroquinoxalin-2-one |
| SMILES | CC1(C)Oc2ccc(Cl)cc2[C@@H]2O[C@@H]3CCCN(CC(=O)N4CC(=O)Nc5ccccc54)[C@@H]3C[C@H]21 |
| InChI | InChI=1S/C27H30ClN3O4/c1-27(2)18-13-21-23(34-26(18)17-12-16(28)9-10-22(17)35-27)8-5-11-30(21)15-25(33)31-14-24(32)29-19-6-3-4-7-20(19)31/h3-4,6-7,9-10,12,18,21,23,26H,5,8,11,13-15H2,1-2H3,(H,29,32)/t18-,21-,23-,26+/m1/s1 |
| InChIKey | IOQYUXFYSIQVSX-BLMQUHDUSA-N |
| XLogP | 4.41 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.01 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |