C19H24ClNO4 — CID 110147553
2-[(1R,10R,12R,17R)-4-chloro-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]acetic acid (PubChem CID 110147553) has the molecular formula C19H24ClNO4 and a molecular weight of 365.86 g/mol. Its IUPAC name is 2-[(1R,10R,12R,17R)-4-chloro-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]acetic acid.
| Compound Name | 2-[(1R,10R,12R,17R)-4-chloro-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]acetic acid |
|---|---|
| PubChem CID | 110147553 |
| Molecular Formula | C19H24ClNO4 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-[(1R,10R,12R,17R)-4-chloro-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]acetic acid |
| SMILES | CC1(C)Oc2ccc(Cl)cc2[C@@H]2O[C@@H]3CCN(CC(=O)O)C[C@H]3C[C@H]21 |
| InChI | InChI=1S/C19H24ClNO4/c1-19(2)14-7-11-9-21(10-17(22)23)6-5-15(11)24-18(14)13-8-12(20)3-4-16(13)25-19/h3-4,8,11,14-15,18H,5-7,9-10H2,1-2H3,(H,22,23)/t11-,14-,15-,18+/m1/s1 |
| InChIKey | NXPPDBBAAJSRLT-FSUOKIBISA-N |
| XLogP | 3.36 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |