C25H29NO5 — CID 110147665
3-[[(1R,10R,12R,17R)-5-hydroxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]methyl]benzoic acid (PubChem CID 110147665) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is 3-[[(1R,10R,12R,17R)-5-hydroxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]methyl]benzoic acid.
| Compound Name | 3-[[(1R,10R,12R,17R)-5-hydroxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 110147665 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 3-[[(1R,10R,12R,17R)-5-hydroxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]methyl]benzoic acid |
| SMILES | CC1(C)Oc2cc(O)ccc2[C@@H]2O[C@@H]3CCN(Cc4cccc(C(=O)O)c4)C[C@H]3C[C@H]21 |
| InChI | InChI=1S/C25H29NO5/c1-25(2)20-11-17-14-26(13-15-4-3-5-16(10-15)24(28)29)9-8-21(17)30-23(20)19-7-6-18(27)12-22(19)31-25/h3-7,10,12,17,20-21,23,27H,8-9,11,13-14H2,1-2H3,(H,28,29)/t17-,20-,21-,23+/m1/s1 |
| InChIKey | GJYUOSWLZYVSMH-TUUKDFBESA-N |
| XLogP | 4.23 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |