C27H33NO5 — CID 110147865
2-[4-[[(1S,10S,12R,17S)-5,9,9-trimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]methyl]phenoxy]acetic acid (PubChem CID 110147865) has the molecular formula C27H33NO5 and a molecular weight of 451.56 g/mol. Its IUPAC name is 2-[4-[[(1S,10S,12R,17S)-5,9,9-trimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[[(1S,10S,12R,17S)-5,9,9-trimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 110147865 |
| Molecular Formula | C27H33NO5 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 2-[4-[[(1S,10S,12R,17S)-5,9,9-trimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]methyl]phenoxy]acetic acid |
| SMILES | Cc1ccc2c(c1)OC(C)(C)[C@H]1C[C@@H]3CN(Cc4ccc(OCC(=O)O)cc4)CC[C@@H]3O[C@H]21 |
| InChI | InChI=1S/C27H33NO5/c1-17-4-9-21-24(12-17)33-27(2,3)22-13-19-15-28(11-10-23(19)32-26(21)22)14-18-5-7-20(8-6-18)31-16-25(29)30/h4-9,12,19,22-23,26H,10-11,13-16H2,1-3H3,(H,29,30)/t19-,22+,23+,26-/m1/s1 |
| InChIKey | REAUWGMXGOHQOC-WVIBYCHQSA-N |
| XLogP | 4.60 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |