C26H31NO5 — CID 110147854
2-[4-[[(1S,10S,12S,17S)-9,9-dimethyl-8,18-dioxa-13-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-trien-13-yl]methyl]phenoxy]acetic acid (PubChem CID 110147854) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is 2-[4-[[(1S,10S,12S,17S)-9,9-dimethyl-8,18-dioxa-13-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-trien-13-yl]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[[(1S,10S,12S,17S)-9,9-dimethyl-8,18-dioxa-13-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-trien-13-yl]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 110147854 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 2-[4-[[(1S,10S,12S,17S)-9,9-dimethyl-8,18-dioxa-13-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6-trien-13-yl]methyl]phenoxy]acetic acid |
| SMILES | CC1(C)Oc2ccccc2[C@H]2O[C@H]3CCCN(Cc4ccc(OCC(=O)O)cc4)[C@H]3C[C@@H]21 |
| InChI | InChI=1S/C26H31NO5/c1-26(2)20-14-21-23(31-25(20)19-6-3-4-7-22(19)32-26)8-5-13-27(21)15-17-9-11-18(12-10-17)30-16-24(28)29/h3-4,6-7,9-12,20-21,23,25H,5,8,13-16H2,1-2H3,(H,28,29)/t20-,21-,23-,25+/m0/s1 |
| InChIKey | DEEOXQDMJFXMMN-FZZWXMEGSA-N |
| XLogP | 4.43 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |