C29H35NO5 — CID 110166556
(E)-3-[4-[[(1R,10R,12R,17R)-6-ethoxy-9,9-dimethyl-8,18-dioxa-13-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-13-yl]methyl]phenyl]prop-2-enoic acid (PubChem CID 110166556) has the molecular formula C29H35NO5 and a molecular weight of 477.60 g/mol. Its IUPAC name is (E)-3-[4-[[(1R,10R,12R,17R)-6-ethoxy-9,9-dimethyl-8,18-dioxa-13-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-13-yl]methyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[(1R,10R,12R,17R)-6-ethoxy-9,9-dimethyl-8,18-dioxa-13-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-13-yl]methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 110166556 |
| Molecular Formula | C29H35NO5 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | (E)-3-[4-[[(1R,10R,12R,17R)-6-ethoxy-9,9-dimethyl-8,18-dioxa-13-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-13-yl]methyl]phenyl]prop-2-enoic acid |
| SMILES | CCOc1cccc2c1OC(C)(C)[C@@H]1C[C@@H]3[C@@H](CCCN3Cc3ccc(/C=C/C(=O)O)cc3)O[C@@H]21 |
| InChI | InChI=1S/C29H35NO5/c1-4-33-25-8-5-7-21-27-22(29(2,3)35-28(21)25)17-23-24(34-27)9-6-16-30(23)18-20-12-10-19(11-13-20)14-15-26(31)32/h5,7-8,10-15,22-24,27H,4,6,9,16-18H2,1-3H3,(H,31,32)/b15-14+/t22-,23-,24-,27+/m1/s1 |
| InChIKey | YKPNACNUBZFFRY-RADFQUNDSA-N |
| XLogP | 5.46 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|