C28H34N2O6 — CID 110147926
2-[[2-[(1R,10R,12R,17R)-6-ethoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]acetyl]amino]benzoic acid (PubChem CID 110147926) has the molecular formula C28H34N2O6 and a molecular weight of 494.59 g/mol. Its IUPAC name is 2-[[2-[(1R,10R,12R,17R)-6-ethoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-[(1R,10R,12R,17R)-6-ethoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 110147926 |
| Molecular Formula | C28H34N2O6 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 2-[[2-[(1R,10R,12R,17R)-6-ethoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]acetyl]amino]benzoic acid |
| SMILES | CCOc1cccc2c1OC(C)(C)[C@@H]1C[C@@H]3CN(CC(=O)Nc4ccccc4C(=O)O)CC[C@H]3O[C@@H]21 |
| InChI | InChI=1S/C28H34N2O6/c1-4-34-23-11-7-9-19-25-20(28(2,3)36-26(19)23)14-17-15-30(13-12-22(17)35-25)16-24(31)29-21-10-6-5-8-18(21)27(32)33/h5-11,17,20,22,25H,4,12-16H2,1-3H3,(H,29,31)(H,32,33)/t17-,20-,22-,25+/m1/s1 |
| InChIKey | CHXGKYPNSMGISD-KJFBJOSPSA-N |
| XLogP | 4.36 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |