C19H27NO3 — CID 110144890
(1S,10S,12S,17S)-6-ethoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene (PubChem CID 110144890) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is (1S,10S,12S,17S)-6-ethoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene.
| Compound Name | (1S,10S,12S,17S)-6-ethoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 110144890 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (1S,10S,12S,17S)-6-ethoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene |
| SMILES | CCOc1cccc2c1OC(C)(C)[C@H]1C[C@H]3CNCC[C@@H]3O[C@H]21 |
| InChI | InChI=1S/C19H27NO3/c1-4-21-16-7-5-6-13-17-14(19(2,3)23-18(13)16)10-12-11-20-9-8-15(12)22-17/h5-7,12,14-15,17,20H,4,8-11H2,1-3H3/t12-,14-,15-,17+/m0/s1 |
| InChIKey | MPIADRJTPOIXMN-NZUILWFCSA-N |
| XLogP | 3.31 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |