C20H27NO5 — CID 175661081
methyl 3-[(1R,9S,10R,12S,17R)-5-hydroxy-9-methyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-9-yl]propanoate (PubChem CID 175661081) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is methyl 3-[(1R,9S,10R,12S,17R)-5-hydroxy-9-methyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-9-yl]propanoate.
| Compound Name | methyl 3-[(1R,9S,10R,12S,17R)-5-hydroxy-9-methyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-9-yl]propanoate |
|---|---|
| PubChem CID | 175661081 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | methyl 3-[(1R,9S,10R,12S,17R)-5-hydroxy-9-methyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-9-yl]propanoate |
| SMILES | COC(=O)CC[C@]1(C)Oc2cc(O)ccc2[C@@H]2O[C@@H]3CCNC[C@@H]3C[C@H]21 |
| InChI | InChI=1S/C20H27NO5/c1-20(7-5-18(23)24-2)15-9-12-11-21-8-6-16(12)25-19(15)14-4-3-13(22)10-17(14)26-20/h3-4,10,12,15-16,19,21-22H,5-9,11H2,1-2H3/t12-,15+,16+,19-,20-/m0/s1 |
| InChIKey | LPZCOVXARBRGBO-HDEUTIAISA-N |
| XLogP | 2.55 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |