C27H31N3O5 — CID 110157238
4-[2-[(1S,10S,12S,17S)-5-hydroxy-9,9-dimethyl-8,18-dioxa-13-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-13-yl]acetyl]-1,3-dihydroquinoxalin-2-one (PubChem CID 110157238) has the molecular formula C27H31N3O5 and a molecular weight of 477.56 g/mol. Its IUPAC name is 4-[2-[(1S,10S,12S,17S)-5-hydroxy-9,9-dimethyl-8,18-dioxa-13-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-13-yl]acetyl]-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-[2-[(1S,10S,12S,17S)-5-hydroxy-9,9-dimethyl-8,18-dioxa-13-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-13-yl]acetyl]-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 110157238 |
| Molecular Formula | C27H31N3O5 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | 4-[2-[(1S,10S,12S,17S)-5-hydroxy-9,9-dimethyl-8,18-dioxa-13-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-13-yl]acetyl]-1,3-dihydroquinoxalin-2-one |
| SMILES | CC1(C)Oc2cc(O)ccc2[C@H]2O[C@H]3CCCN(CC(=O)N4CC(=O)Nc5ccccc54)[C@H]3C[C@@H]21 |
| InChI | InChI=1S/C27H31N3O5/c1-27(2)18-13-21-22(34-26(18)17-10-9-16(31)12-23(17)35-27)8-5-11-29(21)15-25(33)30-14-24(32)28-19-6-3-4-7-20(19)30/h3-4,6-7,9-10,12,18,21-22,26,31H,5,8,11,13-15H2,1-2H3,(H,28,32)/t18-,21-,22-,26+/m0/s1 |
| InChIKey | HVNCLASENAVDOH-HPSBNLBRSA-N |
| XLogP | 3.46 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |