C22H32ClNO5 — CID 171700412
ethyl (1S,10S,12S,17S)-6-ethoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-12-carboxylate;hydrochloride (PubChem CID 171700412) has the molecular formula C22H32ClNO5 and a molecular weight of 425.95 g/mol. Its IUPAC name is ethyl (1S,10S,12S,17S)-6-ethoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-12-carboxylate;hydrochloride.
| Compound Name | ethyl (1S,10S,12S,17S)-6-ethoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-12-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 171700412 |
| Molecular Formula | C22H32ClNO5 |
| Molecular Weight | 425.95 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | ethyl (1S,10S,12S,17S)-6-ethoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-triene-12-carboxylate;hydrochloride |
| SMILES | CCOC(=O)[C@@]12CNCC[C@@H]1O[C@@H]1c3cccc(OCC)c3OC(C)(C)[C@H]1C2.Cl |
| InChI | InChI=1S/C22H31NO5.ClH/c1-5-25-16-9-7-8-14-18-15(21(3,4)28-19(14)16)12-22(20(24)26-6-2)13-23-11-10-17(22)27-18;/h7-9,15,17-18,23H,5-6,10-13H2,1-4H3;1H/t15-,17-,18+,22-;/m0./s1 |
| InChIKey | TYQNAHFACWXWAD-GUIMKSLSSA-N |
| XLogP | 3.67 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.95 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |