C23H34N2O3 — CID 110144389
(2R)-2-amino-3-methyl-1-[(1R,10R,12S,17R)-5,9,9-trimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]butan-1-one (PubChem CID 110144389) has the molecular formula C23H34N2O3 and a molecular weight of 386.54 g/mol. Its IUPAC name is (2R)-2-amino-3-methyl-1-[(1R,10R,12S,17R)-5,9,9-trimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]butan-1-one.
| Compound Name | (2R)-2-amino-3-methyl-1-[(1R,10R,12S,17R)-5,9,9-trimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]butan-1-one |
|---|---|
| PubChem CID | 110144389 |
| Molecular Formula | C23H34N2O3 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | (2R)-2-amino-3-methyl-1-[(1R,10R,12S,17R)-5,9,9-trimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]butan-1-one |
| SMILES | Cc1ccc2c(c1)OC(C)(C)[C@@H]1C[C@H]3CN(C(=O)[C@H](N)C(C)C)CC[C@H]3O[C@@H]21 |
| InChI | InChI=1S/C23H34N2O3/c1-13(2)20(24)22(26)25-9-8-18-15(12-25)11-17-21(27-18)16-7-6-14(3)10-19(16)28-23(17,4)5/h6-7,10,13,15,17-18,20-21H,8-9,11-12,24H2,1-5H3/t15-,17+,18+,20+,21-/m0/s1 |
| InChIKey | ACRNRCNSTRUFSA-MAWREPJSSA-N |
| XLogP | 3.44 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |