C25H35NO5 — CID 110147784
3,3-dimethyl-5-oxo-5-[(1R,10R,12S,17R)-5,9,9-trimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]pentanoic acid (PubChem CID 110147784) has the molecular formula C25H35NO5 and a molecular weight of 429.56 g/mol. Its IUPAC name is 3,3-dimethyl-5-oxo-5-[(1R,10R,12S,17R)-5,9,9-trimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]pentanoic acid.
| Compound Name | 3,3-dimethyl-5-oxo-5-[(1R,10R,12S,17R)-5,9,9-trimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]pentanoic acid |
|---|---|
| PubChem CID | 110147784 |
| Molecular Formula | C25H35NO5 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | 3,3-dimethyl-5-oxo-5-[(1R,10R,12S,17R)-5,9,9-trimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]pentanoic acid |
| SMILES | Cc1ccc2c(c1)OC(C)(C)[C@@H]1C[C@H]3CN(C(=O)CC(C)(C)CC(=O)O)CC[C@H]3O[C@@H]21 |
| InChI | InChI=1S/C25H35NO5/c1-15-6-7-17-20(10-15)31-25(4,5)18-11-16-14-26(9-8-19(16)30-23(17)18)21(27)12-24(2,3)13-22(28)29/h6-7,10,16,18-19,23H,8-9,11-14H2,1-5H3,(H,28,29)/t16-,18+,19+,23-/m0/s1 |
| InChIKey | NGMDZXGAMBTGIN-YIKPNSEUSA-N |
| XLogP | 4.35 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |