C26H38N2O4 — CID 110147839
N-[6-oxo-6-[(1S,10S,12R,17S)-5,9,9-trimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]hexyl]acetamide (PubChem CID 110147839) has the molecular formula C26H38N2O4 and a molecular weight of 442.60 g/mol. Its IUPAC name is N-[6-oxo-6-[(1S,10S,12R,17S)-5,9,9-trimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]hexyl]acetamide.
| Compound Name | N-[6-oxo-6-[(1S,10S,12R,17S)-5,9,9-trimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]hexyl]acetamide |
|---|---|
| PubChem CID | 110147839 |
| Molecular Formula | C26H38N2O4 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | N-[6-oxo-6-[(1S,10S,12R,17S)-5,9,9-trimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]hexyl]acetamide |
| SMILES | CC(=O)NCCCCCC(=O)N1CC[C@@H]2O[C@@H]3c4ccc(C)cc4OC(C)(C)[C@H]3C[C@@H]2C1 |
| InChI | InChI=1S/C26H38N2O4/c1-17-9-10-20-23(14-17)32-26(3,4)21-15-19-16-28(13-11-22(19)31-25(20)21)24(30)8-6-5-7-12-27-18(2)29/h9-10,14,19,21-22,25H,5-8,11-13,15-16H2,1-4H3,(H,27,29)/t19-,21+,22+,25-/m1/s1 |
| InChIKey | KICUUSNFMHVHEZ-TVPUMLRDSA-N |
| XLogP | 4.16 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|