C25H35NO6 — CID 110157192
5-[(1R,10R,12S,17R)-5-methoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 110157192) has the molecular formula C25H35NO6 and a molecular weight of 445.56 g/mol. Its IUPAC name is 5-[(1R,10R,12S,17R)-5-methoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-[(1R,10R,12S,17R)-5-methoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 110157192 |
| Molecular Formula | C25H35NO6 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 5-[(1R,10R,12S,17R)-5-methoxy-9,9-dimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | COc1ccc2c(c1)OC(C)(C)[C@@H]1C[C@H]3CN(C(=O)CC(C)(C)CC(=O)O)CC[C@H]3O[C@@H]21 |
| InChI | InChI=1S/C25H35NO6/c1-24(2,13-22(28)29)12-21(27)26-9-8-19-15(14-26)10-18-23(31-19)17-7-6-16(30-5)11-20(17)32-25(18,3)4/h6-7,11,15,18-19,23H,8-10,12-14H2,1-5H3,(H,28,29)/t15-,18+,19+,23-/m0/s1 |
| InChIKey | ZXQQRZCQZBBCPO-LONFEIEESA-N |
| XLogP | 4.05 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |