C27H29N3O4 — CID 110148038
[(1R,10R,12S,16R)-4-hydroxy-9,9-dimethyl-8,17-dioxa-13-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2(7),3,5-trien-13-yl]-[3-(imidazol-1-ylmethyl)phenyl]methanone (PubChem CID 110148038) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is [(1R,10R,12S,16R)-4-hydroxy-9,9-dimethyl-8,17-dioxa-13-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2(7),3,5-trien-13-yl]-[3-(imidazol-1-ylmethyl)phenyl]methanone.
| Compound Name | [(1R,10R,12S,16R)-4-hydroxy-9,9-dimethyl-8,17-dioxa-13-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2(7),3,5-trien-13-yl]-[3-(imidazol-1-ylmethyl)phenyl]methanone |
|---|---|
| PubChem CID | 110148038 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | [(1R,10R,12S,16R)-4-hydroxy-9,9-dimethyl-8,17-dioxa-13-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2(7),3,5-trien-13-yl]-[3-(imidazol-1-ylmethyl)phenyl]methanone |
| SMILES | CC1(C)Oc2ccc(O)cc2[C@@H]2O[C@@H]3CCN(C(=O)c4cccc(Cn5ccnc5)c4)[C@H]3C[C@H]21 |
| InChI | InChI=1S/C27H29N3O4/c1-27(2)21-14-22-24(33-25(21)20-13-19(31)6-7-23(20)34-27)8-10-30(22)26(32)18-5-3-4-17(12-18)15-29-11-9-28-16-29/h3-7,9,11-13,16,21-22,24-25,31H,8,10,14-15H2,1-2H3/t21-,22+,24-,25+/m1/s1 |
| InChIKey | IWHDSEVLVONMSW-OUMDNPPYSA-N |
| XLogP | 4.17 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |