C25H35NO5 — CID 110147623
5-[(1R,10R,12R,16R)-4-tert-butyl-9,9-dimethyl-8,17-dioxa-13-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2(7),3,5-trien-13-yl]-5-oxopentanoic acid (PubChem CID 110147623) has the molecular formula C25H35NO5 and a molecular weight of 429.56 g/mol. Its IUPAC name is 5-[(1R,10R,12R,16R)-4-tert-butyl-9,9-dimethyl-8,17-dioxa-13-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2(7),3,5-trien-13-yl]-5-oxopentanoic acid.
| Compound Name | 5-[(1R,10R,12R,16R)-4-tert-butyl-9,9-dimethyl-8,17-dioxa-13-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2(7),3,5-trien-13-yl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 110147623 |
| Molecular Formula | C25H35NO5 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | 5-[(1R,10R,12R,16R)-4-tert-butyl-9,9-dimethyl-8,17-dioxa-13-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2(7),3,5-trien-13-yl]-5-oxopentanoic acid |
| SMILES | CC(C)(C)c1ccc2c(c1)[C@@H]1O[C@@H]3CCN(C(=O)CCCC(=O)O)[C@@H]3C[C@H]1C(C)(C)O2 |
| InChI | InChI=1S/C25H35NO5/c1-24(2,3)15-9-10-19-16(13-15)23-17(25(4,5)31-19)14-18-20(30-23)11-12-26(18)21(27)7-6-8-22(28)29/h9-10,13,17-18,20,23H,6-8,11-12,14H2,1-5H3,(H,28,29)/t17-,18-,20-,23+/m1/s1 |
| InChIKey | BXASMZXNSMBCID-MYJYVVNQSA-N |
| XLogP | 4.46 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |