C25H24F3NO5 — CID 110147793
4-[(1R,10R,12R,16R)-9,9-dimethyl-6-(trifluoromethyl)-8,17-dioxa-13-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2(7),3,5-triene-13-carbonyl]benzoic acid (PubChem CID 110147793) has the molecular formula C25H24F3NO5 and a molecular weight of 475.46 g/mol. Its IUPAC name is 4-[(1R,10R,12R,16R)-9,9-dimethyl-6-(trifluoromethyl)-8,17-dioxa-13-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2(7),3,5-triene-13-carbonyl]benzoic acid.
| Compound Name | 4-[(1R,10R,12R,16R)-9,9-dimethyl-6-(trifluoromethyl)-8,17-dioxa-13-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2(7),3,5-triene-13-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 110147793 |
| Molecular Formula | C25H24F3NO5 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 4-[(1R,10R,12R,16R)-9,9-dimethyl-6-(trifluoromethyl)-8,17-dioxa-13-azatetracyclo[8.7.0.02,7.012,16]heptadeca-2(7),3,5-triene-13-carbonyl]benzoic acid |
| SMILES | CC1(C)Oc2c(cccc2C(F)(F)F)[C@@H]2O[C@@H]3CCN(C(=O)c4ccc(C(=O)O)cc4)[C@@H]3C[C@H]21 |
| InChI | InChI=1S/C25H24F3NO5/c1-24(2)17-12-18-19(10-11-29(18)22(30)13-6-8-14(9-7-13)23(31)32)33-20(17)15-4-3-5-16(21(15)34-24)25(26,27)28/h3-9,17-20H,10-12H2,1-2H3,(H,31,32)/t17-,18-,19-,20+/m1/s1 |
| InChIKey | YNEXSFJKPBCDBR-WTGUMLROSA-N |
| XLogP | 4.94 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |