C29H41NO7 — CID 110144907
2-[[(1S,9S,10S,12S,17S)-9-methyl-9-(4-methylpent-3-enyl)-14-[(2-methylpropan-2-yl)oxycarbonyl]-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-6-yl]oxy]acetic acid (PubChem CID 110144907) has the molecular formula C29H41NO7 and a molecular weight of 515.65 g/mol. Its IUPAC name is 2-[[(1S,9S,10S,12S,17S)-9-methyl-9-(4-methylpent-3-enyl)-14-[(2-methylpropan-2-yl)oxycarbonyl]-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-6-yl]oxy]acetic acid.
| Compound Name | 2-[[(1S,9S,10S,12S,17S)-9-methyl-9-(4-methylpent-3-enyl)-14-[(2-methylpropan-2-yl)oxycarbonyl]-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-6-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 110144907 |
| Molecular Formula | C29H41NO7 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | 2-[[(1S,9S,10S,12S,17S)-9-methyl-9-(4-methylpent-3-enyl)-14-[(2-methylpropan-2-yl)oxycarbonyl]-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-6-yl]oxy]acetic acid |
| SMILES | CC(C)=CCC[C@]1(C)Oc2c(OCC(=O)O)cccc2[C@H]2O[C@H]3CCN(C(=O)OC(C)(C)C)C[C@@H]3C[C@@H]21 |
| InChI | InChI=1S/C29H41NO7/c1-18(2)9-8-13-29(6)21-15-19-16-30(27(33)37-28(3,4)5)14-12-22(19)35-25(21)20-10-7-11-23(26(20)36-29)34-17-24(31)32/h7,9-11,19,21-22,25H,8,12-17H2,1-6H3,(H,31,32)/t19-,21-,22-,25+,29-/m0/s1 |
| InChIKey | TUJNKLRZIBQZEY-CDLUFOCUSA-N |
| XLogP | 5.75 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|