C31H45NO8 — CID 110145092
4-[(3R,4aS,5R,10bS)-5-methyl-5-(4-methylpent-3-enyl)-4'-[(2-methylpropan-2-yl)oxycarbonyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,2'-morpholine]-7-yl]oxybutanoic acid (PubChem CID 110145092) has the molecular formula C31H45NO8 and a molecular weight of 559.70 g/mol. Its IUPAC name is 4-[(3R,4aS,5R,10bS)-5-methyl-5-(4-methylpent-3-enyl)-4'-[(2-methylpropan-2-yl)oxycarbonyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,2'-morpholine]-7-yl]oxybutanoic acid.
| Compound Name | 4-[(3R,4aS,5R,10bS)-5-methyl-5-(4-methylpent-3-enyl)-4'-[(2-methylpropan-2-yl)oxycarbonyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,2'-morpholine]-7-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 110145092 |
| Molecular Formula | C31H45NO8 |
| Molecular Weight | 559.70 g/mol |
| Exact Mass | 559.31 |
| IUPAC Name | 4-[(3R,4aS,5R,10bS)-5-methyl-5-(4-methylpent-3-enyl)-4'-[(2-methylpropan-2-yl)oxycarbonyl]spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,2'-morpholine]-7-yl]oxybutanoic acid |
| SMILES | CC(C)=CCC[C@@]1(C)Oc2c(OCCCC(=O)O)cccc2[C@H]2OC[C@@]3(C[C@@H]21)CN(C(=O)OC(C)(C)C)CCO3 |
| InChI | InChI=1S/C31H45NO8/c1-21(2)10-8-14-30(6)23-18-31(19-32(15-17-38-31)28(35)40-29(3,4)5)20-37-26(23)22-11-7-12-24(27(22)39-30)36-16-9-13-25(33)34/h7,10-12,23,26H,8-9,13-20H2,1-6H3,(H,33,34)/t23-,26+,30+,31+/m0/s1 |
| InChIKey | KOBICKHRAGHGTN-SAVWBQNHSA-N |
| XLogP | 5.91 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.70 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|