C30H45NO6 — CID 110145034
tert-butyl (4aS,5R,10bS)-8-(2-hydroxyethoxy)-5-methyl-5-(4-methylpent-3-enyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-carboxylate (PubChem CID 110145034) has the molecular formula C30H45NO6 and a molecular weight of 515.69 g/mol. Its IUPAC name is tert-butyl (4aS,5R,10bS)-8-(2-hydroxyethoxy)-5-methyl-5-(4-methylpent-3-enyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl (4aS,5R,10bS)-8-(2-hydroxyethoxy)-5-methyl-5-(4-methylpent-3-enyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 110145034 |
| Molecular Formula | C30H45NO6 |
| Molecular Weight | 515.69 g/mol |
| Exact Mass | 515.32 |
| IUPAC Name | tert-butyl (4aS,5R,10bS)-8-(2-hydroxyethoxy)-5-methyl-5-(4-methylpent-3-enyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,4'-piperidine]-1'-carboxylate |
| SMILES | CC(C)=CCC[C@@]1(C)Oc2cc(OCCO)ccc2[C@H]2OCC3(CCN(C(=O)OC(C)(C)C)CC3)C[C@@H]21 |
| InChI | InChI=1S/C30H45NO6/c1-21(2)8-7-11-29(6)24-19-30(12-14-31(15-13-30)27(33)37-28(3,4)5)20-35-26(24)23-10-9-22(34-17-16-32)18-25(23)36-29/h8-10,18,24,26,32H,7,11-17,19-20H2,1-6H3/t24-,26+,29+/m0/s1 |
| InChIKey | TVHKQVOWJVZYBA-IHTKTJBKSA-N |
| XLogP | 6.05 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.69 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|