C33H49NO7 — CID 110145023
tert-butyl (3S,4aS,5R,10bS)-8-(4-methoxy-4-oxobutoxy)-5-methyl-5-(4-methylpent-3-enyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-piperidine]-1'-carboxylate (PubChem CID 110145023) has the molecular formula C33H49NO7 and a molecular weight of 571.76 g/mol. Its IUPAC name is tert-butyl (3S,4aS,5R,10bS)-8-(4-methoxy-4-oxobutoxy)-5-methyl-5-(4-methylpent-3-enyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl (3S,4aS,5R,10bS)-8-(4-methoxy-4-oxobutoxy)-5-methyl-5-(4-methylpent-3-enyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 110145023 |
| Molecular Formula | C33H49NO7 |
| Molecular Weight | 571.76 g/mol |
| Exact Mass | 571.35 |
| IUPAC Name | tert-butyl (3S,4aS,5R,10bS)-8-(4-methoxy-4-oxobutoxy)-5-methyl-5-(4-methylpent-3-enyl)spiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-piperidine]-1'-carboxylate |
| SMILES | COC(=O)CCCOc1ccc2c(c1)O[C@](C)(CCC=C(C)C)[C@H]1C[C@]3(CCCN(C(=O)OC(C)(C)C)C3)CO[C@H]21 |
| InChI | InChI=1S/C33H49NO7/c1-23(2)11-8-15-32(6)26-20-33(16-10-17-34(21-33)30(36)41-31(3,4)5)22-39-29(26)25-14-13-24(19-27(25)40-32)38-18-9-12-28(35)37-7/h11,13-14,19,26,29H,8-10,12,15-18,20-22H2,1-7H3/t26-,29+,32+,33-/m0/s1 |
| InChIKey | RDQHCRDTLZNTHR-HYEGGMENSA-N |
| XLogP | 7.01 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.76 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|